C17H8F6O5 — CID 91703647
[4-benzoyl-3-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate (PubChem CID 91703647) has the molecular formula C17H8F6O5 and a molecular weight of 406.23 g/mol. Its IUPAC name is [4-benzoyl-3-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate.
| Compound Name | [4-benzoyl-3-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91703647 |
| Molecular Formula | C17H8F6O5 |
| Molecular Weight | 406.23 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | [4-benzoyl-3-(2,2,2-trifluoroacetyl)oxyphenyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(c1ccccc1)c1ccc(OC(=O)C(F)(F)F)cc1OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H8F6O5/c18-16(19,20)14(25)27-10-6-7-11(13(24)9-4-2-1-3-5-9)12(8-10)28-15(26)17(21,22)23/h1-8H |
| InChIKey | KSUTVLNLILHQRQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.23 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|