C19H14O3 — CID 154134222
[2,4-bis(prop-2-ynoxy)phenyl]-phenylmethanone (PubChem CID 154134222) has the molecular formula C19H14O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is [2,4-bis(prop-2-ynoxy)phenyl]-phenylmethanone.
| Compound Name | [2,4-bis(prop-2-ynoxy)phenyl]-phenylmethanone |
|---|---|
| PubChem CID | 154134222 |
| Molecular Formula | C19H14O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | [2,4-bis(prop-2-ynoxy)phenyl]-phenylmethanone |
| SMILES | C#CCOc1ccc(C(=O)c2ccccc2)c(OCC#C)c1 |
| InChI | InChI=1S/C19H14O3/c1-3-12-21-16-10-11-17(18(14-16)22-13-4-2)19(20)15-8-6-5-7-9-15/h1-2,5-11,14H,12-13H2 |
| InChIKey | OYMBNXKQRHWCQB-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|