C23H28N2O5 — CID 163320636
[4-benzoyl-3-(diethylcarbamoyloxy)phenyl] N,N-diethylcarbamate (PubChem CID 163320636) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [4-benzoyl-3-(diethylcarbamoyloxy)phenyl] N,N-diethylcarbamate.
| Compound Name | [4-benzoyl-3-(diethylcarbamoyloxy)phenyl] N,N-diethylcarbamate |
|---|---|
| PubChem CID | 163320636 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [4-benzoyl-3-(diethylcarbamoyloxy)phenyl] N,N-diethylcarbamate |
| SMILES | CCN(CC)C(=O)Oc1ccc(C(=O)c2ccccc2)c(OC(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C23H28N2O5/c1-5-24(6-2)22(27)29-18-14-15-19(21(26)17-12-10-9-11-13-17)20(16-18)30-23(28)25(7-3)8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | XNLUEDCMQJNOAH-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |