C34H26N2O5 — CID 163320694
[4-acetyl-3-(diphenylcarbamoyloxy)phenyl] N,N-diphenylcarbamate (PubChem CID 163320694) has the molecular formula C34H26N2O5 and a molecular weight of 542.59 g/mol. Its IUPAC name is [4-acetyl-3-(diphenylcarbamoyloxy)phenyl] N,N-diphenylcarbamate.
| Compound Name | [4-acetyl-3-(diphenylcarbamoyloxy)phenyl] N,N-diphenylcarbamate |
|---|---|
| PubChem CID | 163320694 |
| Molecular Formula | C34H26N2O5 |
| Molecular Weight | 542.59 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | [4-acetyl-3-(diphenylcarbamoyloxy)phenyl] N,N-diphenylcarbamate |
| SMILES | CC(=O)c1ccc(OC(=O)N(c2ccccc2)c2ccccc2)cc1OC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H26N2O5/c1-25(37)31-23-22-30(40-33(38)35(26-14-6-2-7-15-26)27-16-8-3-9-17-27)24-32(31)41-34(39)36(28-18-10-4-11-19-28)29-20-12-5-13-21-29/h2-24H,1H3 |
| InChIKey | PNCJGENPVJCLMX-UHFFFAOYSA-N |
| XLogP | 8.56 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.59 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |