C11H13NO4 — CID 163320495
(4-acetyl-3-hydroxyphenyl) N,N-dimethylcarbamate (PubChem CID 163320495) has the molecular formula C11H13NO4 and a molecular weight of 223.23 g/mol. Its IUPAC name is (4-acetyl-3-hydroxyphenyl) N,N-dimethylcarbamate.
| Compound Name | (4-acetyl-3-hydroxyphenyl) N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 163320495 |
| Molecular Formula | C11H13NO4 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | (4-acetyl-3-hydroxyphenyl) N,N-dimethylcarbamate |
| SMILES | CC(=O)c1ccc(OC(=O)N(C)C)cc1O |
| InChI | InChI=1S/C11H13NO4/c1-7(13)9-5-4-8(6-10(9)14)16-11(15)12(2)3/h4-6,14H,1-3H3 |
| InChIKey | VDVWXQLYVOBOBO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |