C9H6BrF3O2 — CID 118797027
(4-bromo-3-methylphenyl) 2,2,2-trifluoroacetate (PubChem CID 118797027) has the molecular formula C9H6BrF3O2 and a molecular weight of 283.04 g/mol. Its IUPAC name is (4-bromo-3-methylphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (4-bromo-3-methylphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118797027 |
| Molecular Formula | C9H6BrF3O2 |
| Molecular Weight | 283.04 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | (4-bromo-3-methylphenyl) 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(OC(=O)C(F)(F)F)ccc1Br |
| InChI | InChI=1S/C9H6BrF3O2/c1-5-4-6(2-3-7(5)10)15-8(14)9(11,12)13/h2-4H,1H3 |
| InChIKey | OTVVCPVVNRFBCA-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.04 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|