C9H6BrF2O3- — CID 162450902
2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetate (PubChem CID 162450902) has the molecular formula C9H6BrF2O3- and a molecular weight of 280.04 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetate.
| Compound Name | 2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162450902 |
| Molecular Formula | C9H6BrF2O3- |
| Molecular Weight | 280.04 g/mol |
| Exact Mass | 278.95 |
| IUPAC Name | 2-(4-bromo-3-methylphenoxy)-2,2-difluoroacetate |
| SMILES | Cc1cc(OC(F)(F)C(=O)[O-])ccc1Br |
| InChI | InChI=1S/C9H7BrF2O3/c1-5-4-6(2-3-7(5)10)15-9(11,12)8(13)14/h2-4H,1H3,(H,13,14)/p-1 |
| InChIKey | DIQIRERVRRVPJL-UHFFFAOYSA-M |
| XLogP | 1.48 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.04 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |