C9H8BrF2NO — CID 130135911
2-(4-bromo-3-methylphenyl)-2,2-difluoroacetamide (PubChem CID 130135911) has the molecular formula C9H8BrF2NO and a molecular weight of 264.07 g/mol. Its IUPAC name is 2-(4-bromo-3-methylphenyl)-2,2-difluoroacetamide.
| Compound Name | 2-(4-bromo-3-methylphenyl)-2,2-difluoroacetamide |
|---|---|
| PubChem CID | 130135911 |
| Molecular Formula | C9H8BrF2NO |
| Molecular Weight | 264.07 g/mol |
| Exact Mass | 262.98 |
| IUPAC Name | 2-(4-bromo-3-methylphenyl)-2,2-difluoroacetamide |
| SMILES | Cc1cc(C(F)(F)C(N)=O)ccc1Br |
| InChI | InChI=1S/C9H8BrF2NO/c1-5-4-6(2-3-7(5)10)9(11,12)8(13)14/h2-4H,1H3,(H2,13,14) |
| InChIKey | DIIXAPCDYBIQOG-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |