C15H22BrNO2 — CID 150894997
[4-(4-bromo-3-methylphenyl)-2,4-dimethylpentan-2-yl] carbamate (PubChem CID 150894997) has the molecular formula C15H22BrNO2 and a molecular weight of 328.25 g/mol. Its IUPAC name is [4-(4-bromo-3-methylphenyl)-2,4-dimethylpentan-2-yl] carbamate.
| Compound Name | [4-(4-bromo-3-methylphenyl)-2,4-dimethylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 150894997 |
| Molecular Formula | C15H22BrNO2 |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | [4-(4-bromo-3-methylphenyl)-2,4-dimethylpentan-2-yl] carbamate |
| SMILES | Cc1cc(C(C)(C)CC(C)(C)OC(N)=O)ccc1Br |
| InChI | InChI=1S/C15H22BrNO2/c1-10-8-11(6-7-12(10)16)14(2,3)9-15(4,5)19-13(17)18/h6-8H,9H2,1-5H3,(H2,17,18) |
| InChIKey | KYUNQGDTLKGHBE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |