About 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate
2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate (PubChem CID 162450917) has the molecular formula C14H7F2O5S-
and a molecular weight of 325.27 g/mol. Its IUPAC name is 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate.
Molecular Properties
| Compound Name | 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate |
| PubChem CID | 162450917 |
| Molecular Formula | C14H7F2O5S- |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate |
| SMILES | O=C([O-])C(F)(F)Oc1ccc2c(c1)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C14H8F2O5S/c15-14(16,13(17)18)21-8-5-6-12-10(7-8)9-3-1-2-4-11(9)22(12,19)20/h1-7H,(H,17,18)/p-1 |
| InChIKey | OZUDGQMLVOWCJS-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate?
The IUPAC name of 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate (CID 162450917) is 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate.
What is the SMILES notation for 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate?
The canonical SMILES for 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate is O=C([O-])C(F)(F)Oc1ccc2c(c1)-c1ccccc1S2(=O)=O.
What is the InChIKey of 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate?
The InChIKey is OZUDGQMLVOWCJS-UHFFFAOYSA-M. The full InChI is InChI=1S/C14H8F2O5S/c15-14(16,13(17)18)21-8-5-6-12-10(7-8)9-3-1-2-4-11(9)22(12,19)20/h1-7H,(H,17,18)/p-1.
What are the key properties of 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate?
2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate has a molecular weight of 325.27 g/mol, XLogP of 1.22, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate is sourced from PubChem (CID 162450917), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).