C14H7F2O5S- — CID 162450917
2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate (PubChem CID 162450917) has the molecular formula C14H7F2O5S- and a molecular weight of 325.27 g/mol. Its IUPAC name is 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate.
| Compound Name | 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate |
|---|---|
| PubChem CID | 162450917 |
| Molecular Formula | C14H7F2O5S- |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.00 |
| IUPAC Name | 2-(5,5-dioxodibenzothiophen-2-yl)oxy-2,2-difluoroacetate |
| SMILES | O=C([O-])C(F)(F)Oc1ccc2c(c1)-c1ccccc1S2(=O)=O |
| InChI | InChI=1S/C14H8F2O5S/c15-14(16,13(17)18)21-8-5-6-12-10(7-8)9-3-1-2-4-11(9)22(12,19)20/h1-7H,(H,17,18)/p-1 |
| InChIKey | OZUDGQMLVOWCJS-UHFFFAOYSA-M |
| XLogP | 1.22 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |