C18H11ClO2S — CID 148523872
2-(4-chlorophenyl)dibenzothiophene 5,5-dioxide (PubChem CID 148523872) has the molecular formula C18H11ClO2S and a molecular weight of 326.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)dibenzothiophene 5,5-dioxide.
| Compound Name | 2-(4-chlorophenyl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 148523872 |
| Molecular Formula | C18H11ClO2S |
| Molecular Weight | 326.80 g/mol |
| Exact Mass | 326.02 |
| IUPAC Name | 2-(4-chlorophenyl)dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2cc(-c3ccc(Cl)cc3)ccc21 |
| InChI | InChI=1S/C18H11ClO2S/c19-14-8-5-12(6-9-14)13-7-10-18-16(11-13)15-3-1-2-4-17(15)22(18,20)21/h1-11H |
| InChIKey | MOYBZWXLBLHPKX-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.80 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |