C47H31NO2S — CID 169131680
8-(4-phenylphenyl)-1-[6-phenyl-4-(4-phenylphenyl)-2-pyridinyl]dibenzothiophene 5,5-dioxide (PubChem CID 169131680) has the molecular formula C47H31NO2S and a molecular weight of 673.84 g/mol. Its IUPAC name is 8-(4-phenylphenyl)-1-[6-phenyl-4-(4-phenylphenyl)-2-pyridinyl]dibenzothiophene 5,5-dioxide.
| Compound Name | 8-(4-phenylphenyl)-1-[6-phenyl-4-(4-phenylphenyl)-2-pyridinyl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 169131680 |
| Molecular Formula | C47H31NO2S |
| Molecular Weight | 673.84 g/mol |
| Exact Mass | 673.21 |
| IUPAC Name | 8-(4-phenylphenyl)-1-[6-phenyl-4-(4-phenylphenyl)-2-pyridinyl]dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccc(-c3ccc(-c4ccccc4)cc3)cc2-c2c(-c3cc(-c4ccc(-c5ccccc5)cc4)cc(-c4ccccc4)n3)cccc21 |
| InChI | InChI=1S/C47H31NO2S/c49-51(50)45-28-27-39(36-23-19-34(20-24-36)32-11-4-1-5-12-32)29-42(45)47-41(17-10-18-46(47)51)44-31-40(30-43(48-44)38-15-8-3-9-16-38)37-25-21-35(22-26-37)33-13-6-2-7-14-33/h1-31H |
| InChIKey | VUGSWBKHKTWVEM-UHFFFAOYSA-N |
| XLogP | 11.90 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.84 |
| LogP ≤ 5 | 11.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |