C47H33N — CID 58943632
2,4-diphenyl-6-[4-[3-phenyl-5-(4-phenylphenyl)phenyl]phenyl]pyridine (PubChem CID 58943632) has the molecular formula C47H33N and a molecular weight of 611.79 g/mol. Its IUPAC name is 2,4-diphenyl-6-[4-[3-phenyl-5-(4-phenylphenyl)phenyl]phenyl]pyridine.
| Compound Name | 2,4-diphenyl-6-[4-[3-phenyl-5-(4-phenylphenyl)phenyl]phenyl]pyridine |
|---|---|
| PubChem CID | 58943632 |
| Molecular Formula | C47H33N |
| Molecular Weight | 611.79 g/mol |
| Exact Mass | 611.26 |
| IUPAC Name | 2,4-diphenyl-6-[4-[3-phenyl-5-(4-phenylphenyl)phenyl]phenyl]pyridine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccccc4)cc(-c4ccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)n5)cc4)c3)cc2)cc1 |
| InChI | InChI=1S/C47H33N/c1-5-13-34(14-6-1)37-21-23-38(24-22-37)43-29-42(35-15-7-2-8-16-35)30-44(31-43)39-25-27-41(28-26-39)47-33-45(36-17-9-3-10-18-36)32-46(48-47)40-19-11-4-12-20-40/h1-33H |
| InChIKey | WVXXEUUJFFXJCZ-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.79 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |