C23H17NO — CID 4640455
4-(2,6-diphenyl-4-pyridinyl)phenol (PubChem CID 4640455) has the molecular formula C23H17NO and a molecular weight of 323.40 g/mol. Its IUPAC name is 4-(2,6-diphenyl-4-pyridinyl)phenol.
| Compound Name | 4-(2,6-diphenyl-4-pyridinyl)phenol |
|---|---|
| PubChem CID | 4640455 |
| Molecular Formula | C23H17NO |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 4-(2,6-diphenyl-4-pyridinyl)phenol |
| SMILES | Oc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C23H17NO/c25-21-13-11-17(12-14-21)20-15-22(18-7-3-1-4-8-18)24-23(16-20)19-9-5-2-6-10-19/h1-16,25H |
| InChIKey | WZFMWLFPJJZIAX-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |