C23H15Cl2N — CID 3640020
2,4-bis(4-chlorophenyl)-6-phenylpyridine (PubChem CID 3640020) has the molecular formula C23H15Cl2N and a molecular weight of 376.29 g/mol. Its IUPAC name is 2,4-bis(4-chlorophenyl)-6-phenylpyridine.
| Compound Name | 2,4-bis(4-chlorophenyl)-6-phenylpyridine |
|---|---|
| PubChem CID | 3640020 |
| Molecular Formula | C23H15Cl2N |
| Molecular Weight | 376.29 g/mol |
| Exact Mass | 375.06 |
| IUPAC Name | 2,4-bis(4-chlorophenyl)-6-phenylpyridine |
| SMILES | Clc1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C23H15Cl2N/c24-20-10-6-16(7-11-20)19-14-22(17-4-2-1-3-5-17)26-23(15-19)18-8-12-21(25)13-9-18/h1-15H |
| InChIKey | QCKBVDLDDBSKJI-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.29 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |