C24H17Cl2N — CID 101453856
2,6-bis(4-chlorophenyl)-4-(4-methylphenyl)pyridine (PubChem CID 101453856) has the molecular formula C24H17Cl2N and a molecular weight of 390.31 g/mol. Its IUPAC name is 2,6-bis(4-chlorophenyl)-4-(4-methylphenyl)pyridine.
| Compound Name | 2,6-bis(4-chlorophenyl)-4-(4-methylphenyl)pyridine |
|---|---|
| PubChem CID | 101453856 |
| Molecular Formula | C24H17Cl2N |
| Molecular Weight | 390.31 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | 2,6-bis(4-chlorophenyl)-4-(4-methylphenyl)pyridine |
| SMILES | Cc1ccc(-c2cc(-c3ccc(Cl)cc3)nc(-c3ccc(Cl)cc3)c2)cc1 |
| InChI | InChI=1S/C24H17Cl2N/c1-16-2-4-17(5-3-16)20-14-23(18-6-10-21(25)11-7-18)27-24(15-20)19-8-12-22(26)13-9-19/h2-15H,1H3 |
| InChIKey | JDQQVOARVRAWDL-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.31 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |