C24H20N2 — CID 134692019
2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine (PubChem CID 134692019) has the molecular formula C24H20N2 and a molecular weight of 336.44 g/mol. Its IUPAC name is 2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine.
| Compound Name | 2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine |
|---|---|
| PubChem CID | 134692019 |
| Molecular Formula | C24H20N2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2,6-bis(4-methylphenyl)-4-pyridin-4-ylpyridine |
| SMILES | Cc1ccc(-c2cc(-c3ccncc3)cc(-c3ccc(C)cc3)n2)cc1 |
| InChI | InChI=1S/C24H20N2/c1-17-3-7-20(8-4-17)23-15-22(19-11-13-25-14-12-19)16-24(26-23)21-9-5-18(2)6-10-21/h3-16H,1-2H3 |
| InChIKey | XWVASFZTYFAOSN-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |