C50H46N6O2 — CID 139195352
4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine (PubChem CID 139195352) has the molecular formula C50H46N6O2 and a molecular weight of 762.96 g/mol. Its IUPAC name is 4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine.
| Compound Name | 4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine |
|---|---|
| PubChem CID | 139195352 |
| Molecular Formula | C50H46N6O2 |
| Molecular Weight | 762.96 g/mol |
| Exact Mass | 762.37 |
| IUPAC Name | 4-(4-butoxyphenyl)-2,6-dipyridin-4-ylpyridine |
| SMILES | CCCCOc1ccc(-c2cc(-c3ccncc3)nc(-c3ccncc3)c2)cc1.CCCCOc1ccc(-c2cc(-c3ccncc3)nc(-c3ccncc3)c2)cc1 |
| InChI | InChI=1S/2C25H23N3O/c2*1-2-3-16-29-23-6-4-19(5-7-23)22-17-24(20-8-12-26-13-9-20)28-25(18-22)21-10-14-27-15-11-21/h2*4-15,17-18H,2-3,16H2,1H3 |
| InChIKey | HVKAKEFGEVPILK-UHFFFAOYSA-N |
| XLogP | 12.10 |
| TPSA | 95.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.96 |
| LogP ≤ 5 | 12.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|