C18H18N2O2 — CID 11779218
5-(4-butoxyphenyl)-2-pyridin-4-yl-1,3-oxazole (PubChem CID 11779218) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-2-pyridin-4-yl-1,3-oxazole.
| Compound Name | 5-(4-butoxyphenyl)-2-pyridin-4-yl-1,3-oxazole |
|---|---|
| PubChem CID | 11779218 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 5-(4-butoxyphenyl)-2-pyridin-4-yl-1,3-oxazole |
| SMILES | CCCCOc1ccc(-c2cnc(-c3ccncc3)o2)cc1 |
| InChI | InChI=1S/C18H18N2O2/c1-2-3-12-21-16-6-4-14(5-7-16)17-13-20-18(22-17)15-8-10-19-11-9-15/h4-11,13H,2-3,12H2,1H3 |
| InChIKey | ARFORILVURWSGM-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|