C27H31NO3 — CID 54384331
2,5-bis(4-hex-2-enoxyphenyl)-1,3-oxazole (PubChem CID 54384331) has the molecular formula C27H31NO3 and a molecular weight of 417.55 g/mol. Its IUPAC name is 2,5-bis(4-hex-2-enoxyphenyl)-1,3-oxazole.
| Compound Name | 2,5-bis(4-hex-2-enoxyphenyl)-1,3-oxazole |
|---|---|
| PubChem CID | 54384331 |
| Molecular Formula | C27H31NO3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.23 |
| IUPAC Name | 2,5-bis(4-hex-2-enoxyphenyl)-1,3-oxazole |
| SMILES | CCCC=CCOc1ccc(-c2cnc(-c3ccc(OCC=CCCC)cc3)o2)cc1 |
| InChI | InChI=1S/C27H31NO3/c1-3-5-7-9-19-29-24-15-11-22(12-16-24)26-21-28-27(31-26)23-13-17-25(18-14-23)30-20-10-8-6-4-2/h7-18,21H,3-6,19-20H2,1-2H3 |
| InChIKey | VCECFUYVVCKKIO-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 44.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|