C17H13NO3 — CID 71501498
[4-(2-phenyl-1,3-oxazol-5-yl)phenyl] acetate (PubChem CID 71501498) has the molecular formula C17H13NO3 and a molecular weight of 279.30 g/mol. Its IUPAC name is [4-(2-phenyl-1,3-oxazol-5-yl)phenyl] acetate.
| Compound Name | [4-(2-phenyl-1,3-oxazol-5-yl)phenyl] acetate |
|---|---|
| PubChem CID | 71501498 |
| Molecular Formula | C17H13NO3 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.09 |
| IUPAC Name | [4-(2-phenyl-1,3-oxazol-5-yl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2cnc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C17H13NO3/c1-12(19)20-15-9-7-13(8-10-15)16-11-18-17(21-16)14-5-3-2-4-6-14/h2-11H,1H3 |
| InChIKey | IHANLPMEVGEWFH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|