C15H10INO — CID 19894925
2-(4-iodophenyl)-5-phenyl-1,3-oxazole (PubChem CID 19894925) has the molecular formula C15H10INO and a molecular weight of 347.16 g/mol. Its IUPAC name is 2-(4-iodophenyl)-5-phenyl-1,3-oxazole.
| Compound Name | 2-(4-iodophenyl)-5-phenyl-1,3-oxazole |
|---|---|
| PubChem CID | 19894925 |
| Molecular Formula | C15H10INO |
| Molecular Weight | 347.16 g/mol |
| Exact Mass | 346.98 |
| IUPAC Name | 2-(4-iodophenyl)-5-phenyl-1,3-oxazole |
| SMILES | Ic1ccc(-c2ncc(-c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C15H10INO/c16-13-8-6-12(7-9-13)15-17-10-14(18-15)11-4-2-1-3-5-11/h1-10H |
| InChIKey | IYDMAOSABBYFFK-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.16 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|