About 4-methylpyridine;4-pyridin-4-ylpyridine
4-methylpyridine;4-pyridin-4-ylpyridine (PubChem CID 118057744) has the molecular formula C16H15N3
and a molecular weight of 249.32 g/mol. Its IUPAC name is 4-methylpyridine;4-pyridin-4-ylpyridine.
Molecular Properties
| Compound Name | 4-methylpyridine;4-pyridin-4-ylpyridine |
| PubChem CID | 118057744 |
| Molecular Formula | C16H15N3 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 4-methylpyridine;4-pyridin-4-ylpyridine |
| SMILES | Cc1ccncc1.c1cc(-c2ccncc2)ccn1 |
| InChI | InChI=1S/C10H8N2.C6H7N/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-6-2-4-7-5-3-6/h1-8H;2-5H,1H3 |
| InChIKey | KLOGJGDOFWHGKA-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-methylpyridine;4-pyridin-4-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylpyridine;4-pyridin-4-ylpyridine?
The IUPAC name of 4-methylpyridine;4-pyridin-4-ylpyridine (CID 118057744) is 4-methylpyridine;4-pyridin-4-ylpyridine.
What is the SMILES notation for 4-methylpyridine;4-pyridin-4-ylpyridine?
The canonical SMILES for 4-methylpyridine;4-pyridin-4-ylpyridine is Cc1ccncc1.c1cc(-c2ccncc2)ccn1.
What is the InChIKey of 4-methylpyridine;4-pyridin-4-ylpyridine?
The InChIKey is KLOGJGDOFWHGKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C6H7N/c1-5-11-6-2-9(1)10-3-7-12-8-4-10;1-6-2-4-7-5-3-6/h1-8H;2-5H,1H3.
What are the key properties of 4-methylpyridine;4-pyridin-4-ylpyridine?
4-methylpyridine;4-pyridin-4-ylpyridine has a molecular weight of 249.32 g/mol, XLogP of 3.53, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylpyridine;4-pyridin-4-ylpyridine is sourced from PubChem (CID 118057744), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).