C41H30N2 — CID 143267281
2-(4,6-diphenyl-2-pyridinyl)-6-[3-(4-methylphenyl)phenyl]-4-phenylpyridine (PubChem CID 143267281) has the molecular formula C41H30N2 and a molecular weight of 550.71 g/mol. Its IUPAC name is 2-(4,6-diphenyl-2-pyridinyl)-6-[3-(4-methylphenyl)phenyl]-4-phenylpyridine.
| Compound Name | 2-(4,6-diphenyl-2-pyridinyl)-6-[3-(4-methylphenyl)phenyl]-4-phenylpyridine |
|---|---|
| PubChem CID | 143267281 |
| Molecular Formula | C41H30N2 |
| Molecular Weight | 550.71 g/mol |
| Exact Mass | 550.24 |
| IUPAC Name | 2-(4,6-diphenyl-2-pyridinyl)-6-[3-(4-methylphenyl)phenyl]-4-phenylpyridine |
| SMILES | Cc1ccc(-c2cccc(-c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)cc(-c5ccccc5)n4)n3)c2)cc1 |
| InChI | InChI=1S/C41H30N2/c1-29-20-22-32(23-21-29)34-18-11-19-35(24-34)39-26-37(31-14-7-3-8-15-31)28-41(43-39)40-27-36(30-12-5-2-6-13-30)25-38(42-40)33-16-9-4-10-17-33/h2-28H,1H3 |
| InChIKey | ZQMBACNIELWGJO-UHFFFAOYSA-N |
| XLogP | 10.79 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.71 |
| LogP ≤ 5 | 10.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |