C35H25N — CID 58943255
2,6-diphenyl-4-[3-(3-phenylphenyl)phenyl]pyridine (PubChem CID 58943255) has the molecular formula C35H25N and a molecular weight of 459.59 g/mol. Its IUPAC name is 2,6-diphenyl-4-[3-(3-phenylphenyl)phenyl]pyridine.
| Compound Name | 2,6-diphenyl-4-[3-(3-phenylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 58943255 |
| Molecular Formula | C35H25N |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2,6-diphenyl-4-[3-(3-phenylphenyl)phenyl]pyridine |
| SMILES | c1ccc(-c2cccc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)c3)c2)cc1 |
| InChI | InChI=1S/C35H25N/c1-4-12-26(13-5-1)29-18-10-19-30(22-29)31-20-11-21-32(23-31)33-24-34(27-14-6-2-7-15-27)36-35(25-33)28-16-8-3-9-17-28/h1-25H |
| InChIKey | HFEVMZXPHXZKEP-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |