C46H32N2 — CID 59428704
4-[3-(2,6-diphenyl-4-pyridinyl)-5-phenylphenyl]-2,6-diphenylpyridine (PubChem CID 59428704) has the molecular formula C46H32N2 and a molecular weight of 612.78 g/mol. Its IUPAC name is 4-[3-(2,6-diphenyl-4-pyridinyl)-5-phenylphenyl]-2,6-diphenylpyridine.
| Compound Name | 4-[3-(2,6-diphenyl-4-pyridinyl)-5-phenylphenyl]-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 59428704 |
| Molecular Formula | C46H32N2 |
| Molecular Weight | 612.78 g/mol |
| Exact Mass | 612.26 |
| IUPAC Name | 4-[3-(2,6-diphenyl-4-pyridinyl)-5-phenylphenyl]-2,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)cc(-c3cc(-c4ccccc4)nc(-c4ccccc4)c3)c2)cc1 |
| InChI | InChI=1S/C46H32N2/c1-6-16-33(17-7-1)38-26-39(41-29-43(34-18-8-2-9-19-34)47-44(30-41)35-20-10-3-11-21-35)28-40(27-38)42-31-45(36-22-12-4-13-23-36)48-46(32-42)37-24-14-5-15-25-37/h1-32H |
| InChIKey | IFABDRWCWMFCTL-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.78 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |