C56H38N4 — CID 58943264
2-[3-[3-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-5-phenylphenyl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 58943264) has the molecular formula C56H38N4 and a molecular weight of 766.95 g/mol. Its IUPAC name is 2-[3-[3-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-5-phenylphenyl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[3-[3-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-5-phenylphenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 58943264 |
| Molecular Formula | C56H38N4 |
| Molecular Weight | 766.95 g/mol |
| Exact Mass | 766.31 |
| IUPAC Name | 2-[3-[3-[3-(2,6-diphenyl-4-pyridinyl)phenyl]-5-phenylphenyl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)c4)c3)cc(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C56H38N4/c1-6-18-39(19-7-1)48-34-49(44-28-16-29-45(32-44)51-37-52(40-20-8-2-9-21-40)57-53(38-51)41-22-10-3-11-23-41)36-50(35-48)46-30-17-31-47(33-46)56-59-54(42-24-12-4-13-25-42)58-55(60-56)43-26-14-5-15-27-43/h1-38H |
| InChIKey | YRESOEBFCGFUEY-UHFFFAOYSA-N |
| XLogP | 14.27 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 766.95 |
| LogP ≤ 5 | 14.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |