C74H50N4 — CID 58943606
2-[4-[3-[4-[2,6-bis(4-phenylphenyl)-4-pyridinyl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine (PubChem CID 58943606) has the molecular formula C74H50N4 and a molecular weight of 995.24 g/mol. Its IUPAC name is 2-[4-[3-[4-[2,6-bis(4-phenylphenyl)-4-pyridinyl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine.
| Compound Name | 2-[4-[3-[4-[2,6-bis(4-phenylphenyl)-4-pyridinyl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 58943606 |
| Molecular Formula | C74H50N4 |
| Molecular Weight | 995.24 g/mol |
| Exact Mass | 994.40 |
| IUPAC Name | 2-[4-[3-[4-[2,6-bis(4-phenylphenyl)-4-pyridinyl]phenyl]phenyl]phenyl]-4,6-bis(4-phenylphenyl)-1,3,5-triazine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccc(-c5cccc(-c6ccc(-c7nc(-c8ccc(-c9ccccc9)cc8)nc(-c8ccc(-c9ccccc9)cc8)n7)cc6)c5)cc4)cc(-c4ccc(-c5ccccc5)cc4)n3)cc2)cc1 |
| InChI | InChI=1S/C74H50N4/c1-5-14-51(15-6-1)55-28-38-62(39-29-55)70-49-69(50-71(75-70)63-40-30-56(31-41-63)52-16-7-2-8-17-52)61-26-24-59(25-27-61)67-22-13-23-68(48-67)60-36-46-66(47-37-60)74-77-72(64-42-32-57(33-43-64)53-18-9-3-10-19-53)76-73(78-74)65-44-34-58(35-45-65)54-20-11-4-12-21-54/h1-50H |
| InChIKey | OVBOZOSCPNXTJE-UHFFFAOYSA-N |
| XLogP | 19.27 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.24 |
| LogP ≤ 5 | 19.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |