C59H41N — CID 121311684
2-phenyl-4,6-bis[3-phenyl-5-(4-phenylphenyl)phenyl]pyridine (PubChem CID 121311684) has the molecular formula C59H41N and a molecular weight of 763.98 g/mol. Its IUPAC name is 2-phenyl-4,6-bis[3-phenyl-5-(4-phenylphenyl)phenyl]pyridine.
| Compound Name | 2-phenyl-4,6-bis[3-phenyl-5-(4-phenylphenyl)phenyl]pyridine |
|---|---|
| PubChem CID | 121311684 |
| Molecular Formula | C59H41N |
| Molecular Weight | 763.98 g/mol |
| Exact Mass | 763.32 |
| IUPAC Name | 2-phenyl-4,6-bis[3-phenyl-5-(4-phenylphenyl)phenyl]pyridine |
| SMILES | c1ccc(-c2ccc(-c3cc(-c4ccccc4)cc(-c4cc(-c5ccccc5)nc(-c5cc(-c6ccccc6)cc(-c6ccc(-c7ccccc7)cc6)c5)c4)c3)cc2)cc1 |
| InChI | InChI=1S/C59H41N/c1-6-16-42(17-7-1)46-26-30-48(31-27-46)52-34-51(44-20-10-3-11-21-44)36-55(37-52)56-40-58(50-24-14-5-15-25-50)60-59(41-56)57-38-53(45-22-12-4-13-23-45)35-54(39-57)49-32-28-47(29-33-49)43-18-8-2-9-19-43/h1-41H |
| InChIKey | NTZHQIUQQUVOJP-UHFFFAOYSA-N |
| XLogP | 16.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.98 |
| LogP ≤ 5 | 16.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |