C70H48N2 — CID 58943331
2-[4-[3-(3,5-diphenylphenyl)-5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]phenyl]phenyl]-4,6-diphenylpyridine (PubChem CID 58943331) has the molecular formula C70H48N2 and a molecular weight of 917.17 g/mol. Its IUPAC name is 2-[4-[3-(3,5-diphenylphenyl)-5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]phenyl]phenyl]-4,6-diphenylpyridine.
| Compound Name | 2-[4-[3-(3,5-diphenylphenyl)-5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]phenyl]phenyl]-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 58943331 |
| Molecular Formula | C70H48N2 |
| Molecular Weight | 917.17 g/mol |
| Exact Mass | 916.38 |
| IUPAC Name | 2-[4-[3-(3,5-diphenylphenyl)-5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]phenyl]phenyl]-4,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccc(-c5cc(-c6ccccc6)nc(-c6ccccc6)c5)cc4)cc(-c4ccc(-c5cc(-c6ccccc6)cc(-c6ccccc6)n5)cc4)c3)c2)cc1 |
| InChI | InChI=1S/C70H48N2/c1-7-19-49(20-8-1)59-39-60(50-21-9-2-10-22-50)42-63(41-59)64-43-61(52-31-33-54(34-32-52)66-47-68(56-27-15-5-16-28-56)71-69(48-66)57-29-17-6-18-30-57)40-62(44-64)53-35-37-58(38-36-53)70-46-65(51-23-11-3-12-24-51)45-67(72-70)55-25-13-4-14-26-55/h1-48H |
| InChIKey | IUKDZCAQIRWXRU-UHFFFAOYSA-N |
| XLogP | 18.81 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.17 |
| LogP ≤ 5 | 18.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |