C56H38N2 — CID 118075155
2-[4-[5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenylpyridine (PubChem CID 118075155) has the molecular formula C56H38N2 and a molecular weight of 738.93 g/mol. Its IUPAC name is 2-[4-[5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenylpyridine.
| Compound Name | 2-[4-[5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenylpyridine |
|---|---|
| PubChem CID | 118075155 |
| Molecular Formula | C56H38N2 |
| Molecular Weight | 738.93 g/mol |
| Exact Mass | 738.30 |
| IUPAC Name | 2-[4-[5-[4-(4,6-diphenyl-2-pyridinyl)phenyl]naphthalen-2-yl]phenyl]-4,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)nc(-c3ccc(-c4ccc5c(-c6ccc(-c7cc(-c8ccccc8)cc(-c8ccccc8)n7)cc6)cccc5c4)cc3)c2)cc1 |
| InChI | InChI=1S/C56H38N2/c1-5-14-39(15-6-1)49-35-53(43-18-9-3-10-19-43)57-55(37-49)45-28-24-41(25-29-45)47-32-33-52-48(34-47)22-13-23-51(52)42-26-30-46(31-27-42)56-38-50(40-16-7-2-8-17-40)36-54(58-56)44-20-11-4-12-21-44/h1-38H |
| InChIKey | CGJHLTPTZOVDFG-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.93 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |