C54H36N4 — CID 121402218
2-[4-[5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 121402218) has the molecular formula C54H36N4 and a molecular weight of 740.91 g/mol. Its IUPAC name is 2-[4-[5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 121402218 |
| Molecular Formula | C54H36N4 |
| Molecular Weight | 740.91 g/mol |
| Exact Mass | 740.29 |
| IUPAC Name | 2-[4-[5-[4-(2,6-diphenyl-4-pyridinyl)phenyl]naphthalen-1-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4cccc5c(-c6ccc(-c7nc(-c8ccccc8)nc(-c8ccccc8)n7)cc6)cccc45)cc3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C54H36N4/c1-5-15-40(16-6-1)50-35-45(36-51(55-50)41-17-7-2-8-18-41)37-27-29-38(30-28-37)46-23-13-26-49-47(24-14-25-48(46)49)39-31-33-44(34-32-39)54-57-52(42-19-9-3-10-20-42)56-53(58-54)43-21-11-4-12-22-43/h1-36H |
| InChIKey | NDULBOBRMAUGMD-UHFFFAOYSA-N |
| XLogP | 13.76 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.91 |
| LogP ≤ 5 | 13.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |