C35H21N3O2S — CID 163540814
2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide (PubChem CID 163540814) has the molecular formula C35H21N3O2S and a molecular weight of 547.64 g/mol. Its IUPAC name is 2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide.
| Compound Name | 2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 163540814 |
| Molecular Formula | C35H21N3O2S |
| Molecular Weight | 547.64 g/mol |
| Exact Mass | 547.14 |
| IUPAC Name | 2-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2cc(-c3nc(-c4cccc5ccccc45)nc(-c4cccc5ccccc45)n3)ccc21 |
| InChI | InChI=1S/C35H21N3O2S/c39-41(40)31-18-6-5-15-27(31)30-21-24(19-20-32(30)41)33-36-34(28-16-7-11-22-9-1-3-13-25(22)28)38-35(37-33)29-17-8-12-23-10-2-4-14-26(23)29/h1-21H |
| InChIKey | FAYAETQKBREFQM-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.64 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |