C61H37N3O2S3 — CID 134595238
2-[4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]dibenzothiophene 5,5-dioxide (PubChem CID 134595238) has the molecular formula C61H37N3O2S3 and a molecular weight of 940.19 g/mol. Its IUPAC name is 2-[4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]dibenzothiophene 5,5-dioxide.
| Compound Name | 2-[4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 134595238 |
| Molecular Formula | C61H37N3O2S3 |
| Molecular Weight | 940.19 g/mol |
| Exact Mass | 939.20 |
| IUPAC Name | 2-[4-[2-[3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]dibenzothiophene 5,5-dioxide |
| SMILES | O=S1(=O)c2ccccc2-c2cc(-c3ccc(-c4cc5c(-c6ccccc6)c6sc(-c7cccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)c7)cc6c(-c6ccccc6)c5s4)cc3)ccc21 |
| InChI | InChI=1S/C61H37N3O2S3/c65-69(66)53-27-14-13-26-47(53)48-35-44(32-33-54(48)69)38-28-30-39(31-29-38)51-36-49-55(40-16-5-1-6-17-40)58-50(56(57(49)67-51)41-18-7-2-8-19-41)37-52(68-58)45-24-15-25-46(34-45)61-63-59(42-20-9-3-10-21-42)62-60(64-61)43-22-11-4-12-23-43/h1-37H |
| InChIKey | KUZTUPSNJUOREH-UHFFFAOYSA-N |
| XLogP | 16.45 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 940.19 |
| LogP ≤ 5 | 16.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |