C40H24O3S3 — CID 134595231
3-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]phenoxathiine 10,10-dioxide (PubChem CID 134595231) has the molecular formula C40H24O3S3 and a molecular weight of 648.83 g/mol. Its IUPAC name is 3-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]phenoxathiine 10,10-dioxide.
| Compound Name | 3-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]phenoxathiine 10,10-dioxide |
|---|---|
| PubChem CID | 134595231 |
| Molecular Formula | C40H24O3S3 |
| Molecular Weight | 648.83 g/mol |
| Exact Mass | 648.09 |
| IUPAC Name | 3-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]phenoxathiine 10,10-dioxide |
| SMILES | O=S1(=O)c2ccccc2Oc2cc(-c3cccc(-c4cc5c(-c6ccccc6)c6sccc6c(-c6ccccc6)c5s4)c3)ccc21 |
| InChI | InChI=1S/C40H24O3S3/c41-46(42)35-17-8-7-16-32(35)43-33-23-28(18-19-36(33)46)27-14-9-15-29(22-27)34-24-31-38(26-12-5-2-6-13-26)39-30(20-21-44-39)37(40(31)45-34)25-10-3-1-4-11-25/h1-24H |
| InChIKey | MEYOGNODCNJABP-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.83 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |