C44H28N2S2 — CID 134587733
4-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]-2,6-diphenylpyrimidine (PubChem CID 134587733) has the molecular formula C44H28N2S2 and a molecular weight of 648.86 g/mol. Its IUPAC name is 4-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]-2,6-diphenylpyrimidine.
| Compound Name | 4-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]-2,6-diphenylpyrimidine |
|---|---|
| PubChem CID | 134587733 |
| Molecular Formula | C44H28N2S2 |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.17 |
| IUPAC Name | 4-[3-(4,8-diphenylthieno[2,3-f][1]benzothiol-2-yl)phenyl]-2,6-diphenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3cccc(-c4cc5c(-c6ccccc6)c6sccc6c(-c6ccccc6)c5s4)c3)nc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C44H28N2S2/c1-5-14-29(15-6-1)37-28-38(46-44(45-37)32-20-11-4-12-21-32)33-22-13-23-34(26-33)39-27-36-41(31-18-9-3-10-19-31)42-35(24-25-47-42)40(43(36)48-39)30-16-7-2-8-17-30/h1-28H |
| InChIKey | YHYXXKJPCBPDPN-UHFFFAOYSA-N |
| XLogP | 12.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | 12.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |