C64H40N6S2 — CID 134595214
2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]-4,6-diphenyl-1,3,5-triazine (PubChem CID 134595214) has the molecular formula C64H40N6S2 and a molecular weight of 957.20 g/mol. Its IUPAC name is 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]-4,6-diphenyl-1,3,5-triazine.
| Compound Name | 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 134595214 |
| Molecular Formula | C64H40N6S2 |
| Molecular Weight | 957.20 g/mol |
| Exact Mass | 956.28 |
| IUPAC Name | 2-[4-[2-[4-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4,8-diphenylthieno[2,3-f][1]benzothiol-6-yl]phenyl]-4,6-diphenyl-1,3,5-triazine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3ccc(-c4cc5c(-c6ccccc6)c6sc(-c7ccc(-c8nc(-c9ccccc9)nc(-c9ccccc9)n8)cc7)cc6c(-c6ccccc6)c5s4)cc3)n2)cc1 |
| InChI | InChI=1S/C64H40N6S2/c1-7-19-43(20-8-1)55-51-39-53(41-31-35-49(36-32-41)63-67-59(45-23-11-3-12-24-45)65-60(68-63)46-25-13-4-14-26-46)72-58(51)56(44-21-9-2-10-22-44)52-40-54(71-57(52)55)42-33-37-50(38-34-42)64-69-61(47-27-15-5-16-28-47)66-62(70-64)48-29-17-6-18-30-48/h1-40H |
| InChIKey | ZSGSYJIBLFWCLK-UHFFFAOYSA-N |
| XLogP | 17.16 |
| TPSA | 77.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 72 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 957.20 |
| LogP ≤ 5 | 17.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |