C45H35N3O2S — CID 166018110
3'-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-thioxanthene] 10',10'-dioxide (PubChem CID 166018110) has the molecular formula C45H35N3O2S and a molecular weight of 681.86 g/mol. Its IUPAC name is 3'-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-thioxanthene] 10',10'-dioxide.
| Compound Name | 3'-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-thioxanthene] 10',10'-dioxide |
|---|---|
| PubChem CID | 166018110 |
| Molecular Formula | C45H35N3O2S |
| Molecular Weight | 681.86 g/mol |
| Exact Mass | 681.24 |
| IUPAC Name | 3'-(4,6-dinaphthalen-1-yl-1,3,5-triazin-2-yl)spiro[adamantane-2,9'-thioxanthene] 10',10'-dioxide |
| SMILES | O=S1(=O)c2ccccc2C2(c3ccc(-c4nc(-c5cccc6ccccc56)nc(-c5cccc6ccccc56)n4)cc31)C1CC3CC(C1)CC2C3 |
| InChI | InChI=1S/C45H35N3O2S/c49-51(50)40-18-6-5-17-38(40)45(32-22-27-21-28(24-32)25-33(45)23-27)39-20-19-31(26-41(39)51)42-46-43(36-15-7-11-29-9-1-3-13-34(29)36)48-44(47-42)37-16-8-12-30-10-2-4-14-35(30)37/h1-20,26-28,32-33H,21-25H2 |
| InChIKey | XPKDBWIEPDVIFO-UHFFFAOYSA-N |
| XLogP | 10.07 |
| TPSA | 72.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.86 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |