C59H47N3Si — CID 168803666
2-[7'-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-dinaphthalen-1-yl-1,3,5-triazine (PubChem CID 168803666) has the molecular formula C59H47N3Si and a molecular weight of 826.13 g/mol. Its IUPAC name is 2-[7'-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-dinaphthalen-1-yl-1,3,5-triazine.
| Compound Name | 2-[7'-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-dinaphthalen-1-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 168803666 |
| Molecular Formula | C59H47N3Si |
| Molecular Weight | 826.13 g/mol |
| Exact Mass | 825.35 |
| IUPAC Name | 2-[7'-(5,5-dimethylbenzo[b][1]benzosilol-4-yl)spiro[adamantane-2,9'-fluorene]-2'-yl]-4,6-dinaphthalen-1-yl-1,3,5-triazine |
| SMILES | C[Si]1(C)c2ccccc2-c2cccc(-c3ccc4c(c3)C3(c5cc(-c6nc(-c7cccc8ccccc78)nc(-c7cccc8ccccc78)n6)ccc5-4)C4CC5CC(C4)CC3C5)c21 |
| InChI | InChI=1S/C59H47N3Si/c1-63(2)54-23-8-7-18-48(54)49-20-11-19-45(55(49)63)39-24-26-46-47-27-25-40(34-53(47)59(52(46)33-39)41-29-35-28-36(31-41)32-42(59)30-35)56-60-57(50-21-9-14-37-12-3-5-16-43(37)50)62-58(61-56)51-22-10-15-38-13-4-6-17-44(38)51/h3-27,33-36,41-42H,28-32H2,1-2H3 |
| InChIKey | RRSYTAJVDJRHOH-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 826.13 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|