C24H23BO4S — CID 169131621
2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophene 5,5-dioxide (PubChem CID 169131621) has the molecular formula C24H23BO4S and a molecular weight of 418.32 g/mol. Its IUPAC name is 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophene 5,5-dioxide.
| Compound Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 169131621 |
| Molecular Formula | C24H23BO4S |
| Molecular Weight | 418.32 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]dibenzothiophene 5,5-dioxide |
| SMILES | CC1(C)OB(c2ccc(-c3ccc4c(c3)-c3ccccc3S4(=O)=O)cc2)OC1(C)C |
| InChI | InChI=1S/C24H23BO4S/c1-23(2)24(3,4)29-25(28-23)18-12-9-16(10-13-18)17-11-14-22-20(15-17)19-7-5-6-8-21(19)30(22,26)27/h5-15H,1-4H3 |
| InChIKey | GUAHVUVBIGJPHQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.32 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|