C30H25BO5S — CID 169131800
3-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]dibenzothiophene 5,5-dioxide (PubChem CID 169131800) has the molecular formula C30H25BO5S and a molecular weight of 508.40 g/mol. Its IUPAC name is 3-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]dibenzothiophene 5,5-dioxide.
| Compound Name | 3-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]dibenzothiophene 5,5-dioxide |
|---|---|
| PubChem CID | 169131800 |
| Molecular Formula | C30H25BO5S |
| Molecular Weight | 508.40 g/mol |
| Exact Mass | 508.15 |
| IUPAC Name | 3-[9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)dibenzofuran-2-yl]dibenzothiophene 5,5-dioxide |
| SMILES | CC1(C)OB(c2cccc3oc4ccc(-c5ccc6c(c5)S(=O)(=O)c5ccccc5-6)cc4c23)OC1(C)C |
| InChI | InChI=1S/C30H25BO5S/c1-29(2)30(3,4)36-31(35-29)23-9-7-10-25-28(23)22-16-18(13-15-24(22)34-25)19-12-14-21-20-8-5-6-11-26(20)37(32,33)27(21)17-19/h5-17H,1-4H3 |
| InChIKey | ZZQDDBACFFGOQU-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.40 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|