C31H27BO3S — CID 169131617
4,4,5,5-tetramethyl-2-[8-(5-methylidenedibenzothiophen-3-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane (PubChem CID 169131617) has the molecular formula C31H27BO3S and a molecular weight of 490.43 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[8-(5-methylidenedibenzothiophen-3-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[8-(5-methylidenedibenzothiophen-3-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 169131617 |
| Molecular Formula | C31H27BO3S |
| Molecular Weight | 490.43 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[8-(5-methylidenedibenzothiophen-3-yl)dibenzofuran-1-yl]-1,3,2-dioxaborolane |
| SMILES | C=S1c2ccccc2-c2ccc(-c3ccc4oc5cccc(B6OC(C)(C)C(C)(C)O6)c5c4c3)cc21 |
| InChI | InChI=1S/C31H27BO3S/c1-30(2)31(3,4)35-32(34-30)24-10-8-11-26-29(24)23-17-19(14-16-25(23)33-26)20-13-15-22-21-9-6-7-12-27(21)36(5)28(22)18-20/h6-18H,5H2,1-4H3 |
| InChIKey | WZEPNDUTQNXQIW-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.43 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|