C19H23BO2 — CID 131375544
4,4,5,5-tetramethyl-2-[4-(3-methylphenyl)phenyl]-1,3,2-dioxaborolane (PubChem CID 131375544) has the molecular formula C19H23BO2 and a molecular weight of 294.20 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(3-methylphenyl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(3-methylphenyl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 131375544 |
| Molecular Formula | C19H23BO2 |
| Molecular Weight | 294.20 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(3-methylphenyl)phenyl]-1,3,2-dioxaborolane |
| SMILES | Cc1cccc(-c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)c1 |
| InChI | InChI=1S/C19H23BO2/c1-14-7-6-8-16(13-14)15-9-11-17(12-10-15)20-21-18(2,3)19(4,5)22-20/h6-13H,1-5H3 |
| InChIKey | HGCGJJLNXNVWRM-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.20 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|