C18H22BNO2 — CID 131375541
3-Methyl-5-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine (PubChem CID 131375541) has the molecular formula C18H22BNO2 and a molecular weight of 295.20 g/mol. Its IUPAC name is 3-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine.
| Compound Name | 3-Methyl-5-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)pyridine |
|---|---|
| PubChem CID | 131375541 |
| Molecular Formula | C18H22BNO2 |
| Molecular Weight | 295.20 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 3-methyl-5-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]pyridine |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C3=CN=CC(=C3)C |
| InChI | InChI=1S/C18H22BNO2/c1-13-10-15(12-20-11-13)14-6-8-16(9-7-14)19-21-17(2,3)18(4,5)22-19/h6-12H,1-5H3 |
| InChIKey | GMUWDKSEUCLLTO-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 31.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | 375 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|