C18H20BO3P — CID 175044062
4,4,5,5-tetramethyl-2-[4-(4-phosphorosophenyl)phenyl]-1,3,2-dioxaborolane (PubChem CID 175044062) has the molecular formula C18H20BO3P and a molecular weight of 326.14 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-(4-phosphorosophenyl)phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-(4-phosphorosophenyl)phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 175044062 |
| Molecular Formula | C18H20BO3P |
| Molecular Weight | 326.14 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-(4-phosphorosophenyl)phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(P=O)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C18H20BO3P/c1-17(2)18(3,4)22-19(21-17)15-9-5-13(6-10-15)14-7-11-16(23-20)12-8-14/h5-12H,1-4H3 |
| InChIKey | ZCDNAMXVKCUWAD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.14 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|