C19H20BF3O3 — CID 156643582
4,4,5,5-tetramethyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborolane (PubChem CID 156643582) has the molecular formula C19H20BF3O3 and a molecular weight of 364.17 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 156643582 |
| Molecular Formula | C19H20BF3O3 |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C19H20BF3O3/c1-17(2)18(3,4)26-20(25-17)15-9-5-13(6-10-15)14-7-11-16(12-8-14)24-19(21,22)23/h5-12H,1-4H3 |
| InChIKey | OVNKVKIOYOZHRA-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|