C19H20BF3O3 — CID 139617397
5-propyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborinane (PubChem CID 139617397) has the molecular formula C19H20BF3O3 and a molecular weight of 364.17 g/mol. Its IUPAC name is 5-propyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborinane.
| Compound Name | 5-propyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborinane |
|---|---|
| PubChem CID | 139617397 |
| Molecular Formula | C19H20BF3O3 |
| Molecular Weight | 364.17 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 5-propyl-2-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,3,2-dioxaborinane |
| SMILES | CCCC1COB(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)OC1 |
| InChI | InChI=1S/C19H20BF3O3/c1-2-3-14-12-24-20(25-13-14)17-8-4-15(5-9-17)16-6-10-18(11-7-16)26-19(21,22)23/h4-11,14H,2-3,12-13H2,1H3 |
| InChIKey | ARJBXTCNILIPOR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.17 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|