C22H27F3OSi — CID 22875778
1-methyl-4-propyl-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane (PubChem CID 22875778) has the molecular formula C22H27F3OSi and a molecular weight of 392.54 g/mol. Its IUPAC name is 1-methyl-4-propyl-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane.
| Compound Name | 1-methyl-4-propyl-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane |
|---|---|
| PubChem CID | 22875778 |
| Molecular Formula | C22H27F3OSi |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 1-methyl-4-propyl-1-[4-[4-(trifluoromethoxy)phenyl]phenyl]silinane |
| SMILES | CCCC1CC[Si](C)(c2ccc(-c3ccc(OC(F)(F)F)cc3)cc2)CC1 |
| InChI | InChI=1S/C22H27F3OSi/c1-3-4-17-13-15-27(2,16-14-17)21-11-7-19(8-12-21)18-5-9-20(10-6-18)26-22(23,24)25/h5-12,17H,3-4,13-16H2,1-2H3 |
| InChIKey | OOYDTAYOIJFODX-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|