C26H37F3O — CID 19767143
1-[1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]-4-(trifluoromethoxy)benzene (PubChem CID 19767143) has the molecular formula C26H37F3O and a molecular weight of 422.58 g/mol. Its IUPAC name is 1-[1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]-4-(trifluoromethoxy)benzene.
| Compound Name | 1-[1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]-4-(trifluoromethoxy)benzene |
|---|---|
| PubChem CID | 19767143 |
| Molecular Formula | C26H37F3O |
| Molecular Weight | 422.58 g/mol |
| Exact Mass | 422.28 |
| IUPAC Name | 1-[1-[4-(4-propylcyclohexyl)cyclohexyl]but-3-enyl]-4-(trifluoromethoxy)benzene |
| SMILES | C=CCC(c1ccc(OC(F)(F)F)cc1)C1CCC(C2CCC(CCC)CC2)CC1 |
| InChI | InChI=1S/C26H37F3O/c1-3-5-19-7-9-20(10-8-19)21-11-13-22(14-12-21)25(6-4-2)23-15-17-24(18-16-23)30-26(27,28)29/h4,15-22,25H,2-3,5-14H2,1H3 |
| InChIKey | YIRJGQLFTTWLEC-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.58 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|