C26H31F3O — CID 20809535
(4aR,6R,8aR)-2-propyl-6-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 20809535) has the molecular formula C26H31F3O and a molecular weight of 416.53 g/mol. Its IUPAC name is (4aR,6R,8aR)-2-propyl-6-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | (4aR,6R,8aR)-2-propyl-6-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 20809535 |
| Molecular Formula | C26H31F3O |
| Molecular Weight | 416.53 g/mol |
| Exact Mass | 416.23 |
| IUPAC Name | (4aR,6R,8aR)-2-propyl-6-[4-[4-(trifluoromethoxy)phenyl]phenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | CCCC1CC[C@@H]2C[C@H](c3ccc(-c4ccc(OC(F)(F)F)cc4)cc3)CC[C@@H]2C1 |
| InChI | InChI=1S/C26H31F3O/c1-2-3-18-4-5-24-17-23(11-10-22(24)16-18)21-8-6-19(7-9-21)20-12-14-25(15-13-20)30-26(27,28)29/h6-9,12-15,18,22-24H,2-5,10-11,16-17H2,1H3/t18?,22-,23-,24-/m1/s1 |
| InChIKey | VDKOFYWVHXFYML-YPEJVWIKSA-N |
| XLogP | 8.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.53 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |